C19H30O2 — CID 163036268
(3R)-5-[(1S,2R,8aR)-1,2,5-trimethyl-3,7,8,8a-tetrahydro-2H-naphthalen-1-yl]-3-methylpentanoic acid (PubChem CID 163036268) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is (3R)-5-[(1S,2R,8aR)-1,2,5-trimethyl-3,7,8,8a-tetrahydro-2H-naphthalen-1-yl]-3-methylpentanoic acid.
| Compound Name | (3R)-5-[(1S,2R,8aR)-1,2,5-trimethyl-3,7,8,8a-tetrahydro-2H-naphthalen-1-yl]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 163036268 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | (3R)-5-[(1S,2R,8aR)-1,2,5-trimethyl-3,7,8,8a-tetrahydro-2H-naphthalen-1-yl]-3-methylpentanoic acid |
| SMILES | CC1=CCC[C@H]2C1=CC[C@@H](C)[C@]2(C)CC[C@@H](C)CC(=O)O |
| InChI | InChI=1S/C19H30O2/c1-13(12-18(20)21)10-11-19(4)15(3)8-9-16-14(2)6-5-7-17(16)19/h6,9,13,15,17H,5,7-8,10-12H2,1-4H3,(H,20,21)/t13-,15-,17+,19+/m1/s1 |
| InChIKey | OBLQYEPQXABCJQ-OVLVRJBISA-N |
| XLogP | 5.21 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |