C26H36O6 — CID 163036311
methyl (1R,4S,4aS,8aR)-5,5,8a-trimethyl-4-[(Z)-2-methylbut-2-enoyl]oxy-1-[2-(5-oxo-2H-furan-4-yl)ethyl]-1,4,4a,6,7,8-hexahydronaphthalene-2-carboxylate (PubChem CID 163036311) has the molecular formula C26H36O6 and a molecular weight of 444.57 g/mol. Its IUPAC name is methyl (1R,4S,4aS,8aR)-5,5,8a-trimethyl-4-[(Z)-2-methylbut-2-enoyl]oxy-1-[2-(5-oxo-2H-furan-4-yl)ethyl]-1,4,4a,6,7,8-hexahydronaphthalene-2-carboxylate.
| Compound Name | methyl (1R,4S,4aS,8aR)-5,5,8a-trimethyl-4-[(Z)-2-methylbut-2-enoyl]oxy-1-[2-(5-oxo-2H-furan-4-yl)ethyl]-1,4,4a,6,7,8-hexahydronaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 163036311 |
| Molecular Formula | C26H36O6 |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | methyl (1R,4S,4aS,8aR)-5,5,8a-trimethyl-4-[(Z)-2-methylbut-2-enoyl]oxy-1-[2-(5-oxo-2H-furan-4-yl)ethyl]-1,4,4a,6,7,8-hexahydronaphthalene-2-carboxylate |
| SMILES | C/C=C(/C)C(=O)O[C@H]1C=C(C(=O)OC)[C@H](CCC2=CCOC2=O)[C@@]2(C)CCCC(C)(C)[C@H]12 |
| InChI | InChI=1S/C26H36O6/c1-7-16(2)22(27)32-20-15-18(24(29)30-6)19(10-9-17-11-14-31-23(17)28)26(5)13-8-12-25(3,4)21(20)26/h7,11,15,19-21H,8-10,12-14H2,1-6H3/b16-7-/t19-,20-,21-,26+/m0/s1 |
| InChIKey | QRURQHMRWODLAF-RVIVHHIXSA-N |
| XLogP | 4.69 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|