About (7R)-7-methyltetradecane
(7R)-7-methyltetradecane (PubChem CID 163036465) has the molecular formula C15H32
and a molecular weight of 212.42 g/mol. Its IUPAC name is (7R)-7-methyltetradecane.
Molecular Properties
| Compound Name | (7R)-7-methyltetradecane |
| PubChem CID | 163036465 |
| Molecular Formula | C15H32 |
| Molecular Weight | 212.42 g/mol |
| Exact Mass | 212.25 |
| IUPAC Name | (7R)-7-methyltetradecane |
| SMILES | CCCCCCC[C@H](C)CCCCCC |
| InChI | InChI=1S/C15H32/c1-4-6-8-10-12-14-15(3)13-11-9-7-5-2/h15H,4-14H2,1-3H3/t15-/m1/s1 |
| InChIKey | QUMVEMCGRQYIQG-OAHLLOKOSA-N |
| XLogP | 5.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 212.42 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (7R)-7-methyltetradecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7R)-7-methyltetradecane?
The IUPAC name of (7R)-7-methyltetradecane (CID 163036465) is (7R)-7-methyltetradecane.
What is the SMILES notation for (7R)-7-methyltetradecane?
The canonical SMILES for (7R)-7-methyltetradecane is CCCCCCC[C@H](C)CCCCCC.
What is the InChIKey of (7R)-7-methyltetradecane?
The InChIKey is QUMVEMCGRQYIQG-OAHLLOKOSA-N. The full InChI is InChI=1S/C15H32/c1-4-6-8-10-12-14-15(3)13-11-9-7-5-2/h15H,4-14H2,1-3H3/t15-/m1/s1.
What are the key properties of (7R)-7-methyltetradecane?
(7R)-7-methyltetradecane has a molecular weight of 212.42 g/mol, XLogP of 5.95, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (7R)-7-methyltetradecane is sourced from PubChem (CID 163036465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).