About methyl (2R)-2-(3-bromo-5-hydroxy-4-methoxyphenyl)-3-(2,3-dibromo-4,5-dihydroxyphenyl)propanoate
methyl (2R)-2-(3-bromo-5-hydroxy-4-methoxyphenyl)-3-(2,3-dibromo-4,5-dihydroxyphenyl)propanoate (PubChem CID 163036580) has the molecular formula C17H15Br3O6
and a molecular weight of 555.01 g/mol. Its IUPAC name is methyl (2R)-2-(3-bromo-5-hydroxy-4-methoxyphenyl)-3-(2,3-dibromo-4,5-dihydroxyphenyl)propanoate.
Molecular Properties
| Compound Name | methyl (2R)-2-(3-bromo-5-hydroxy-4-methoxyphenyl)-3-(2,3-dibromo-4,5-dihydroxyphenyl)propanoate |
| PubChem CID | 163036580 |
| Molecular Formula | C17H15Br3O6 |
| Molecular Weight | 555.01 g/mol |
| Exact Mass | 551.84 |
| IUPAC Name | methyl (2R)-2-(3-bromo-5-hydroxy-4-methoxyphenyl)-3-(2,3-dibromo-4,5-dihydroxyphenyl)propanoate |
| SMILES | COC(=O)[C@H](Cc1cc(O)c(O)c(Br)c1Br)c1cc(O)c(OC)c(Br)c1 |
| InChI | InChI=1S/C17H15Br3O6/c1-25-16-10(18)4-7(5-12(16)22)9(17(24)26-2)3-8-6-11(21)15(23)14(20)13(8)19/h4-6,9,21-23H,3H2,1-2H3/t9-/m1/s1 |
| InChIKey | CGWFVWNCURPETC-SECBINFHSA-N |
| XLogP | 4.60 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 555.01 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze methyl (2R)-2-(3-bromo-5-hydroxy-4-methoxyphenyl)-3-(2,3-dibromo-4,5-dihydroxyphenyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-2-(3-bromo-5-hydroxy-4-methoxyphenyl)-3-(2,3-dibromo-4,5-dihydroxyphenyl)propanoate?
The IUPAC name of methyl (2R)-2-(3-bromo-5-hydroxy-4-methoxyphenyl)-3-(2,3-dibromo-4,5-dihydroxyphenyl)propanoate (CID 163036580) is methyl (2R)-2-(3-bromo-5-hydroxy-4-methoxyphenyl)-3-(2,3-dibromo-4,5-dihydroxyphenyl)propanoate.
What is the SMILES notation for methyl (2R)-2-(3-bromo-5-hydroxy-4-methoxyphenyl)-3-(2,3-dibromo-4,5-dihydroxyphenyl)propanoate?
The canonical SMILES for methyl (2R)-2-(3-bromo-5-hydroxy-4-methoxyphenyl)-3-(2,3-dibromo-4,5-dihydroxyphenyl)propanoate is COC(=O)[C@H](Cc1cc(O)c(O)c(Br)c1Br)c1cc(O)c(OC)c(Br)c1.
What is the InChIKey of methyl (2R)-2-(3-bromo-5-hydroxy-4-methoxyphenyl)-3-(2,3-dibromo-4,5-dihydroxyphenyl)propanoate?
The InChIKey is CGWFVWNCURPETC-SECBINFHSA-N. The full InChI is InChI=1S/C17H15Br3O6/c1-25-16-10(18)4-7(5-12(16)22)9(17(24)26-2)3-8-6-11(21)15(23)14(20)13(8)19/h4-6,9,21-23H,3H2,1-2H3/t9-/m1/s1.
What are the key properties of methyl (2R)-2-(3-bromo-5-hydroxy-4-methoxyphenyl)-3-(2,3-dibromo-4,5-dihydroxyphenyl)propanoate?
methyl (2R)-2-(3-bromo-5-hydroxy-4-methoxyphenyl)-3-(2,3-dibromo-4,5-dihydroxyphenyl)propanoate has a molecular weight of 555.01 g/mol, XLogP of 4.60, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-2-(3-bromo-5-hydroxy-4-methoxyphenyl)-3-(2,3-dibromo-4,5-dihydroxyphenyl)propanoate is sourced from PubChem (CID 163036580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).