C22H34O5 — CID 163036684
methyl (1R,4aS,5R,5'R,8aR)-5'-(2-methoxy-2-oxoethyl)-1,4a,5',6-tetramethylspiro[3,4,8,8a-tetrahydro-2H-naphthalene-5,2'-oxolane]-1-carboxylate (PubChem CID 163036684) has the molecular formula C22H34O5 and a molecular weight of 378.51 g/mol. Its IUPAC name is methyl (1R,4aS,5R,5'R,8aR)-5'-(2-methoxy-2-oxoethyl)-1,4a,5',6-tetramethylspiro[3,4,8,8a-tetrahydro-2H-naphthalene-5,2'-oxolane]-1-carboxylate.
| Compound Name | methyl (1R,4aS,5R,5'R,8aR)-5'-(2-methoxy-2-oxoethyl)-1,4a,5',6-tetramethylspiro[3,4,8,8a-tetrahydro-2H-naphthalene-5,2'-oxolane]-1-carboxylate |
|---|---|
| PubChem CID | 163036684 |
| Molecular Formula | C22H34O5 |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | methyl (1R,4aS,5R,5'R,8aR)-5'-(2-methoxy-2-oxoethyl)-1,4a,5',6-tetramethylspiro[3,4,8,8a-tetrahydro-2H-naphthalene-5,2'-oxolane]-1-carboxylate |
| SMILES | COC(=O)C[C@@]1(C)CC[C@@]2(O1)C(C)=CC[C@H]1[C@](C)(C(=O)OC)CCC[C@@]12C |
| InChI | InChI=1S/C22H34O5/c1-15-8-9-16-20(3,18(24)26-6)10-7-11-21(16,4)22(15)13-12-19(2,27-22)14-17(23)25-5/h8,16H,7,9-14H2,1-6H3/t16-,19+,20+,21-,22+/m0/s1 |
| InChIKey | YSYZPARABHAHEC-LOONRQLCSA-N |
| XLogP | 4.19 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|