C20H30O2 — CID 163036766
(1S,6R,11R,12S,15S)-11-hydroxy-6,12,16-trimethyl-2-methylidenetricyclo[7.5.2.012,15]hexadec-9(16)-en-10-one (PubChem CID 163036766) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (1S,6R,11R,12S,15S)-11-hydroxy-6,12,16-trimethyl-2-methylidenetricyclo[7.5.2.012,15]hexadec-9(16)-en-10-one.
| Compound Name | (1S,6R,11R,12S,15S)-11-hydroxy-6,12,16-trimethyl-2-methylidenetricyclo[7.5.2.012,15]hexadec-9(16)-en-10-one |
|---|---|
| PubChem CID | 163036766 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (1S,6R,11R,12S,15S)-11-hydroxy-6,12,16-trimethyl-2-methylidenetricyclo[7.5.2.012,15]hexadec-9(16)-en-10-one |
| SMILES | C=C1CCC[C@@H](C)CCC2=C(C)[C@@H]3[C@@H]1CC[C@]3(C)[C@@H](O)C2=O |
| InChI | InChI=1S/C20H30O2/c1-12-6-5-7-13(2)15-10-11-20(4)17(15)14(3)16(9-8-12)18(21)19(20)22/h12,15,17,19,22H,2,5-11H2,1,3-4H3/t12-,15-,17-,19+,20+/m1/s1 |
| InChIKey | VXHXPUWLVSAWNZ-WQBXYVDTSA-N |
| XLogP | 4.44 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|