C22H34O3 — CID 163037475
5-(3-ethoxy-3-methylpenta-1,4-dienyl)-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylic acid (PubChem CID 163037475) has the molecular formula C22H34O3 and a molecular weight of 346.51 g/mol. Its IUPAC name is 5-(3-ethoxy-3-methylpenta-1,4-dienyl)-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylic acid.
| Compound Name | 5-(3-ethoxy-3-methylpenta-1,4-dienyl)-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 163037475 |
| Molecular Formula | C22H34O3 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.25 |
| IUPAC Name | 5-(3-ethoxy-3-methylpenta-1,4-dienyl)-1,4a-dimethyl-6-methylidene-3,4,5,7,8,8a-hexahydro-2H-naphthalene-1-carboxylic acid |
| SMILES | C=CC(C)(C=CC1C(=C)CCC2C(C)(C(=O)O)CCCC12C)OCC |
| InChI | InChI=1S/C22H34O3/c1-7-20(4,25-8-2)15-12-17-16(3)10-11-18-21(17,5)13-9-14-22(18,6)19(23)24/h7,12,15,17-18H,1,3,8-11,13-14H2,2,4-6H3,(H,23,24) |
| InChIKey | SYNXNPMKKDIYLB-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|