C26H40N2O3 — CID 163038077
(1S,9S)-11-[11-[(2S)-oxolan-2-yl]undecanoyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one (PubChem CID 163038077) has the molecular formula C26H40N2O3 and a molecular weight of 428.62 g/mol. Its IUPAC name is (1S,9S)-11-[11-[(2S)-oxolan-2-yl]undecanoyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one.
| Compound Name | (1S,9S)-11-[11-[(2S)-oxolan-2-yl]undecanoyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
|---|---|
| PubChem CID | 163038077 |
| Molecular Formula | C26H40N2O3 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.30 |
| IUPAC Name | (1S,9S)-11-[11-[(2S)-oxolan-2-yl]undecanoyl]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-dien-6-one |
| SMILES | O=C(CCCCCCCCCC[C@H]1CCCO1)N1C[C@@H]2C[C@@H](C1)c1cccc(=O)n1C2 |
| InChI | InChI=1S/C26H40N2O3/c29-25(14-8-6-4-2-1-3-5-7-11-23-12-10-16-31-23)27-18-21-17-22(20-27)24-13-9-15-26(30)28(24)19-21/h9,13,15,21-23H,1-8,10-12,14,16-20H2/t21-,22-,23-/m0/s1 |
| InChIKey | NGAURBKPBYVXDO-VABKMULXSA-N |
| XLogP | 4.87 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|