C33H56 — CID 163038136
(3R,7R,10R,11E,13S,16E)-13-ethenyl-2,3,7,10,13,17,21-heptamethyl-6,20-dimethylidenedocosa-1,11,16-triene (PubChem CID 163038136) has the molecular formula C33H56 and a molecular weight of 452.81 g/mol. Its IUPAC name is (3R,7R,10R,11E,13S,16E)-13-ethenyl-2,3,7,10,13,17,21-heptamethyl-6,20-dimethylidenedocosa-1,11,16-triene.
| Compound Name | (3R,7R,10R,11E,13S,16E)-13-ethenyl-2,3,7,10,13,17,21-heptamethyl-6,20-dimethylidenedocosa-1,11,16-triene |
|---|---|
| PubChem CID | 163038136 |
| Molecular Formula | C33H56 |
| Molecular Weight | 452.81 g/mol |
| Exact Mass | 452.44 |
| IUPAC Name | (3R,7R,10R,11E,13S,16E)-13-ethenyl-2,3,7,10,13,17,21-heptamethyl-6,20-dimethylidenedocosa-1,11,16-triene |
| SMILES | C=C[C@@](C)(/C=C/[C@H](C)CC[C@@H](C)C(=C)CC[C@@H](C)C(=C)C)CC/C=C(\C)CCC(=C)C(C)C |
| InChI | InChI=1S/C33H56/c1-13-33(12,23-14-15-27(6)16-18-29(8)25(2)3)24-22-28(7)17-19-31(10)32(11)21-20-30(9)26(4)5/h13,15,22,24-25,28,30-31H,1,4,8,11,14,16-21,23H2,2-3,5-7,9-10,12H3/b24-22+,27-15+/t28-,30-,31-,33-/m1/s1 |
| InChIKey | CYEFRELIABSDAV-KTHYUNLOSA-N |
| XLogP | 11.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.81 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|