C15H16O3 — CID 163038239
3,5a,9-trimethyl-3a,9b-dihydro-3H-benzo[g][1]benzofuran-2,8-dione (PubChem CID 163038239) has the molecular formula C15H16O3 and a molecular weight of 244.29 g/mol. Its IUPAC name is 3,5a,9-trimethyl-3a,9b-dihydro-3H-benzo[g][1]benzofuran-2,8-dione.
| Compound Name | 3,5a,9-trimethyl-3a,9b-dihydro-3H-benzo[g][1]benzofuran-2,8-dione |
|---|---|
| PubChem CID | 163038239 |
| Molecular Formula | C15H16O3 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 3,5a,9-trimethyl-3a,9b-dihydro-3H-benzo[g][1]benzofuran-2,8-dione |
| SMILES | CC1=C2C3OC(=O)C(C)C3C=CC2(C)C=CC1=O |
| InChI | InChI=1S/C15H16O3/c1-8-10-4-6-15(3)7-5-11(16)9(2)12(15)13(10)18-14(8)17/h4-8,10,13H,1-3H3 |
| InChIKey | ZEGCVEWSCPBQRU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|