C17H23N3O3 — CID 163038528
(1S,10S,13S)-13-(hydroxymethyl)-9-methyl-10-propan-2-yl-3,9,12-triazatricyclo[6.6.1.04,15]pentadeca-4(15),5,7-triene-2,11-dione (PubChem CID 163038528) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is (1S,10S,13S)-13-(hydroxymethyl)-9-methyl-10-propan-2-yl-3,9,12-triazatricyclo[6.6.1.04,15]pentadeca-4(15),5,7-triene-2,11-dione.
| Compound Name | (1S,10S,13S)-13-(hydroxymethyl)-9-methyl-10-propan-2-yl-3,9,12-triazatricyclo[6.6.1.04,15]pentadeca-4(15),5,7-triene-2,11-dione |
|---|---|
| PubChem CID | 163038528 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | (1S,10S,13S)-13-(hydroxymethyl)-9-methyl-10-propan-2-yl-3,9,12-triazatricyclo[6.6.1.04,15]pentadeca-4(15),5,7-triene-2,11-dione |
| SMILES | CC(C)[C@H]1C(=O)N[C@H](CO)C[C@@H]2C(=O)Nc3cccc(c32)N1C |
| InChI | InChI=1S/C17H23N3O3/c1-9(2)15-17(23)18-10(8-21)7-11-14-12(19-16(11)22)5-4-6-13(14)20(15)3/h4-6,9-11,15,21H,7-8H2,1-3H3,(H,18,23)(H,19,22)/t10-,11-,15-/m0/s1 |
| InChIKey | KYWSVMSQMZBSDV-PGUXBMHVSA-N |
| XLogP | 1.06 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |