C21H30O5 — CID 163038761
[(1S,2S,5S,7S,8R,11R,12R)-7-hydroxy-5-methoxy-14,14-dimethyl-6-oxatetracyclo[9.2.1.04,12.08,12]tetradec-3-en-2-yl] (Z)-2-methylbut-2-enoate (PubChem CID 163038761) has the molecular formula C21H30O5 and a molecular weight of 362.47 g/mol. Its IUPAC name is [(1S,2S,5S,7S,8R,11R,12R)-7-hydroxy-5-methoxy-14,14-dimethyl-6-oxatetracyclo[9.2.1.04,12.08,12]tetradec-3-en-2-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(1S,2S,5S,7S,8R,11R,12R)-7-hydroxy-5-methoxy-14,14-dimethyl-6-oxatetracyclo[9.2.1.04,12.08,12]tetradec-3-en-2-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 163038761 |
| Molecular Formula | C21H30O5 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | [(1S,2S,5S,7S,8R,11R,12R)-7-hydroxy-5-methoxy-14,14-dimethyl-6-oxatetracyclo[9.2.1.04,12.08,12]tetradec-3-en-2-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)O[C@H]1C=C2[C@@H](OC)O[C@H](O)[C@@H]3CC[C@@H]4C(C)(C)[C@@H]1C[C@@]243 |
| InChI | InChI=1S/C21H30O5/c1-6-11(2)17(22)25-15-9-13-19(24-5)26-18(23)12-7-8-16-20(3,4)14(15)10-21(12,13)16/h6,9,12,14-16,18-19,23H,7-8,10H2,1-5H3/b11-6-/t12-,14+,15-,16+,18-,19-,21+/m0/s1 |
| InChIKey | JVMIMRFLGUGLOG-OXKCFXLVSA-N |
| XLogP | 3.18 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|