C36H60N2O6 — CID 163038982
2-[3-[11-(ethylamino)-1-(2-hydroxyethoxy)-10-methyl-6-methylideneundeca-2,4,9-trien-2-yl]-4,10-dihydroxy-6-(3-hydroxypropyl)-10-[2-(methylamino)ethyl]spiro[4.5]decan-7-ylidene]propanal (PubChem CID 163038982) has the molecular formula C36H60N2O6 and a molecular weight of 616.88 g/mol. Its IUPAC name is 2-[3-[11-(ethylamino)-1-(2-hydroxyethoxy)-10-methyl-6-methylideneundeca-2,4,9-trien-2-yl]-4,10-dihydroxy-6-(3-hydroxypropyl)-10-[2-(methylamino)ethyl]spiro[4.5]decan-7-ylidene]propanal.
| Compound Name | 2-[3-[11-(ethylamino)-1-(2-hydroxyethoxy)-10-methyl-6-methylideneundeca-2,4,9-trien-2-yl]-4,10-dihydroxy-6-(3-hydroxypropyl)-10-[2-(methylamino)ethyl]spiro[4.5]decan-7-ylidene]propanal |
|---|---|
| PubChem CID | 163038982 |
| Molecular Formula | C36H60N2O6 |
| Molecular Weight | 616.88 g/mol |
| Exact Mass | 616.45 |
| IUPAC Name | 2-[3-[11-(ethylamino)-1-(2-hydroxyethoxy)-10-methyl-6-methylideneundeca-2,4,9-trien-2-yl]-4,10-dihydroxy-6-(3-hydroxypropyl)-10-[2-(methylamino)ethyl]spiro[4.5]decan-7-ylidene]propanal |
| SMILES | C=C(C=CC=C(COCCO)C1CCC2(C(CCCO)C(=C(C)C=O)CCC2(O)CCNC)C1O)CCC=C(C)CNCC |
| InChI | InChI=1S/C36H60N2O6/c1-6-38-24-28(3)12-7-10-27(2)11-8-13-30(26-44-23-22-40)32-16-18-36(34(32)42)33(14-9-21-39)31(29(4)25-41)15-17-35(36,43)19-20-37-5/h8,11-13,25,32-34,37-40,42-43H,2,6-7,9-10,14-24,26H2,1,3-5H3 |
| InChIKey | XOCMWVKRQWVEDK-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 131.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.88 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|