C25H50O2 — CID 163038984
(E,6S,10R,13R,14S,18S)-2,6,10,14,18-pentamethylicos-15-ene-2,13-diol (PubChem CID 163038984) has the molecular formula C25H50O2 and a molecular weight of 382.67 g/mol. Its IUPAC name is (E,6S,10R,13R,14S,18S)-2,6,10,14,18-pentamethylicos-15-ene-2,13-diol.
| Compound Name | (E,6S,10R,13R,14S,18S)-2,6,10,14,18-pentamethylicos-15-ene-2,13-diol |
|---|---|
| PubChem CID | 163038984 |
| Molecular Formula | C25H50O2 |
| Molecular Weight | 382.67 g/mol |
| Exact Mass | 382.38 |
| IUPAC Name | (E,6S,10R,13R,14S,18S)-2,6,10,14,18-pentamethylicos-15-ene-2,13-diol |
| SMILES | CC[C@H](C)C/C=C/[C@H](C)[C@H](O)CC[C@H](C)CCC[C@H](C)CCCC(C)(C)O |
| InChI | InChI=1S/C25H50O2/c1-8-20(2)12-10-16-23(5)24(26)18-17-22(4)14-9-13-21(3)15-11-19-25(6,7)27/h10,16,20-24,26-27H,8-9,11-15,17-19H2,1-7H3/b16-10+/t20-,21-,22+,23-,24+/m0/s1 |
| InChIKey | LVOIAUYYMRCVLX-CDVIFZHFSA-N |
| XLogP | 7.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.67 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|