About 3-[(1R)-1-hydroxyethyl]-4-[(1E,3E)-penta-1,3-dienyl]-2H-furan-5-one
3-[(1R)-1-hydroxyethyl]-4-[(1E,3E)-penta-1,3-dienyl]-2H-furan-5-one (PubChem CID 163039644) has the molecular formula C11H14O3
and a molecular weight of 194.23 g/mol. Its IUPAC name is 3-[(1R)-1-hydroxyethyl]-4-[(1E,3E)-penta-1,3-dienyl]-2H-furan-5-one.
Molecular Properties
| Compound Name | 3-[(1R)-1-hydroxyethyl]-4-[(1E,3E)-penta-1,3-dienyl]-2H-furan-5-one |
| PubChem CID | 163039644 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 3-[(1R)-1-hydroxyethyl]-4-[(1E,3E)-penta-1,3-dienyl]-2H-furan-5-one |
| SMILES | C/C=C/C=C/C1=C([C@@H](C)O)COC1=O |
| InChI | InChI=1S/C11H14O3/c1-3-4-5-6-9-10(8(2)12)7-14-11(9)13/h3-6,8,12H,7H2,1-2H3/b4-3+,6-5+/t8-/m1/s1 |
| InChIKey | FGXKLJPRSLZOMS-IUNRWVRJSA-N |
| XLogP | 1.35 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1R)-1-hydroxyethyl]-4-[(1E,3E)-penta-1,3-dienyl]-2H-furan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1R)-1-hydroxyethyl]-4-[(1E,3E)-penta-1,3-dienyl]-2H-furan-5-one?
The IUPAC name of 3-[(1R)-1-hydroxyethyl]-4-[(1E,3E)-penta-1,3-dienyl]-2H-furan-5-one (CID 163039644) is 3-[(1R)-1-hydroxyethyl]-4-[(1E,3E)-penta-1,3-dienyl]-2H-furan-5-one.
What is the SMILES notation for 3-[(1R)-1-hydroxyethyl]-4-[(1E,3E)-penta-1,3-dienyl]-2H-furan-5-one?
The canonical SMILES for 3-[(1R)-1-hydroxyethyl]-4-[(1E,3E)-penta-1,3-dienyl]-2H-furan-5-one is C/C=C/C=C/C1=C([C@@H](C)O)COC1=O.
What is the InChIKey of 3-[(1R)-1-hydroxyethyl]-4-[(1E,3E)-penta-1,3-dienyl]-2H-furan-5-one?
The InChIKey is FGXKLJPRSLZOMS-IUNRWVRJSA-N. The full InChI is InChI=1S/C11H14O3/c1-3-4-5-6-9-10(8(2)12)7-14-11(9)13/h3-6,8,12H,7H2,1-2H3/b4-3+,6-5+/t8-/m1/s1.
What are the key properties of 3-[(1R)-1-hydroxyethyl]-4-[(1E,3E)-penta-1,3-dienyl]-2H-furan-5-one?
3-[(1R)-1-hydroxyethyl]-4-[(1E,3E)-penta-1,3-dienyl]-2H-furan-5-one has a molecular weight of 194.23 g/mol, XLogP of 1.35, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1R)-1-hydroxyethyl]-4-[(1E,3E)-penta-1,3-dienyl]-2H-furan-5-one is sourced from PubChem (CID 163039644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).