About 6,7-dimethoxy-4a,8a-dihydrochromen-2-one
6,7-dimethoxy-4a,8a-dihydrochromen-2-one (PubChem CID 163040076) has the molecular formula C11H12O4
and a molecular weight of 208.21 g/mol. Its IUPAC name is 6,7-dimethoxy-4a,8a-dihydrochromen-2-one.
Molecular Properties
| Compound Name | 6,7-dimethoxy-4a,8a-dihydrochromen-2-one |
| PubChem CID | 163040076 |
| Molecular Formula | C11H12O4 |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 6,7-dimethoxy-4a,8a-dihydrochromen-2-one |
| SMILES | COC1=CC2C=CC(=O)OC2C=C1OC |
| InChI | InChI=1S/C11H12O4/c1-13-9-5-7-3-4-11(12)15-8(7)6-10(9)14-2/h3-8H,1-2H3 |
| InChIKey | LXSMPRAHGIBJFU-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6,7-dimethoxy-4a,8a-dihydrochromen-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethoxy-4a,8a-dihydrochromen-2-one?
The IUPAC name of 6,7-dimethoxy-4a,8a-dihydrochromen-2-one (CID 163040076) is 6,7-dimethoxy-4a,8a-dihydrochromen-2-one.
What is the SMILES notation for 6,7-dimethoxy-4a,8a-dihydrochromen-2-one?
The canonical SMILES for 6,7-dimethoxy-4a,8a-dihydrochromen-2-one is COC1=CC2C=CC(=O)OC2C=C1OC.
What is the InChIKey of 6,7-dimethoxy-4a,8a-dihydrochromen-2-one?
The InChIKey is LXSMPRAHGIBJFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O4/c1-13-9-5-7-3-4-11(12)15-8(7)6-10(9)14-2/h3-8H,1-2H3.
What are the key properties of 6,7-dimethoxy-4a,8a-dihydrochromen-2-one?
6,7-dimethoxy-4a,8a-dihydrochromen-2-one has a molecular weight of 208.21 g/mol, XLogP of 1.16, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethoxy-4a,8a-dihydrochromen-2-one is sourced from PubChem (CID 163040076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).