C17H20O5 — CID 163040650
(5R,6S,7S,10R)-10-[(1E,3E)-hepta-1,3-dienyl]-6,7-dihydroxy-3-methylidene-2-oxaspiro[4.5]dec-8-ene-1,4-dione (PubChem CID 163040650) has the molecular formula C17H20O5 and a molecular weight of 304.34 g/mol. Its IUPAC name is (5R,6S,7S,10R)-10-[(1E,3E)-hepta-1,3-dienyl]-6,7-dihydroxy-3-methylidene-2-oxaspiro[4.5]dec-8-ene-1,4-dione.
| Compound Name | (5R,6S,7S,10R)-10-[(1E,3E)-hepta-1,3-dienyl]-6,7-dihydroxy-3-methylidene-2-oxaspiro[4.5]dec-8-ene-1,4-dione |
|---|---|
| PubChem CID | 163040650 |
| Molecular Formula | C17H20O5 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | (5R,6S,7S,10R)-10-[(1E,3E)-hepta-1,3-dienyl]-6,7-dihydroxy-3-methylidene-2-oxaspiro[4.5]dec-8-ene-1,4-dione |
| SMILES | C=C1OC(=O)[C@@]2(C1=O)[C@H](O)[C@@H](O)C=C[C@H]2/C=C/C=C/CCC |
| InChI | InChI=1S/C17H20O5/c1-3-4-5-6-7-8-12-9-10-13(18)15(20)17(12)14(19)11(2)22-16(17)21/h5-10,12-13,15,18,20H,2-4H2,1H3/b6-5+,8-7+/t12-,13+,15-,17+/m1/s1 |
| InChIKey | GIXMLHVPEUCNBI-ZJEWQDOFSA-N |
| XLogP | 1.43 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|