C29H42O8 — CID 163041020
2,16-dihydroxy-4,4,9,13-tetramethyl-17-(2,5,6-trihydroxy-6-methyl-3-oxoheptan-2-yl)-7,8,10,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-3,11-dione (PubChem CID 163041020) has the molecular formula C29H42O8 and a molecular weight of 518.65 g/mol. Its IUPAC name is 2,16-dihydroxy-4,4,9,13-tetramethyl-17-(2,5,6-trihydroxy-6-methyl-3-oxoheptan-2-yl)-7,8,10,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-3,11-dione.
| Compound Name | 2,16-dihydroxy-4,4,9,13-tetramethyl-17-(2,5,6-trihydroxy-6-methyl-3-oxoheptan-2-yl)-7,8,10,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-3,11-dione |
|---|---|
| PubChem CID | 163041020 |
| Molecular Formula | C29H42O8 |
| Molecular Weight | 518.65 g/mol |
| Exact Mass | 518.29 |
| IUPAC Name | 2,16-dihydroxy-4,4,9,13-tetramethyl-17-(2,5,6-trihydroxy-6-methyl-3-oxoheptan-2-yl)-7,8,10,12,14,15,16,17-octahydrocyclopenta[a]phenanthrene-3,11-dione |
| SMILES | CC1(C)C(=O)C(O)=CC2C1=CCC1C3CC(O)C(C(C)(O)C(=O)CC(O)C(C)(C)O)C3(C)CC(=O)C21C |
| InChI | InChI=1S/C29H42O8/c1-25(2)14-8-9-15-16-10-18(30)23(29(7,37)21(33)12-20(32)26(3,4)36)27(16,5)13-22(34)28(15,6)17(14)11-19(31)24(25)35/h8,11,15-18,20,23,30-32,36-37H,9-10,12-13H2,1-7H3 |
| InChIKey | XNBLVCUKUVBYKB-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 152.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.65 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|