C38H49N3O6 — CID 163041309
13-[3-[5-(2-amino-4-pyridinyl)-1,2-dihydroxy-6-(1H-pyrrol-2-yl)hexan-3-yl]oxy-4-hydroxyphenyl]-7-ethylbicyclo[8.5.0]pentadec-11-en-8-yne-2,15-diol (PubChem CID 163041309) has the molecular formula C38H49N3O6 and a molecular weight of 643.83 g/mol. Its IUPAC name is 13-[3-[5-(2-amino-4-pyridinyl)-1,2-dihydroxy-6-(1H-pyrrol-2-yl)hexan-3-yl]oxy-4-hydroxyphenyl]-7-ethylbicyclo[8.5.0]pentadec-11-en-8-yne-2,15-diol.
| Compound Name | 13-[3-[5-(2-amino-4-pyridinyl)-1,2-dihydroxy-6-(1H-pyrrol-2-yl)hexan-3-yl]oxy-4-hydroxyphenyl]-7-ethylbicyclo[8.5.0]pentadec-11-en-8-yne-2,15-diol |
|---|---|
| PubChem CID | 163041309 |
| Molecular Formula | C38H49N3O6 |
| Molecular Weight | 643.83 g/mol |
| Exact Mass | 643.36 |
| IUPAC Name | 13-[3-[5-(2-amino-4-pyridinyl)-1,2-dihydroxy-6-(1H-pyrrol-2-yl)hexan-3-yl]oxy-4-hydroxyphenyl]-7-ethylbicyclo[8.5.0]pentadec-11-en-8-yne-2,15-diol |
| SMILES | CCC1C#CC2C=CC(c3ccc(O)c(OC(CC(Cc4ccc[nH]4)c4ccnc(N)c4)C(O)CO)c3)CC(O)C2C(O)CCCC1 |
| InChI | InChI=1S/C38H49N3O6/c1-2-24-6-3-4-8-32(44)38-25(10-9-24)11-12-26(19-33(38)45)27-13-14-31(43)35(20-27)47-36(34(46)23-42)21-29(18-30-7-5-16-40-30)28-15-17-41-37(39)22-28/h5,7,11-17,20,22,24-26,29,32-34,36,38,40,42-46H,2-4,6,8,18-19,21,23H2,1H3,(H2,39,41) |
| InChIKey | LCTCRMMHZSXNHK-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 165.08 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.83 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|