About 3,7,9-trimethylpurine-6,8-dione
3,7,9-trimethylpurine-6,8-dione (PubChem CID 163041436) has the molecular formula C8H10N4O2
and a molecular weight of 194.19 g/mol. Its IUPAC name is 3,7,9-trimethylpurine-6,8-dione.
Molecular Properties
| Compound Name | 3,7,9-trimethylpurine-6,8-dione |
| PubChem CID | 163041436 |
| Molecular Formula | C8H10N4O2 |
| Molecular Weight | 194.19 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | 3,7,9-trimethylpurine-6,8-dione |
| SMILES | Cn1cnc(=O)c2c1n(C)c(=O)n2C |
| InChI | InChI=1S/C8H10N4O2/c1-10-4-9-6(13)5-7(10)12(3)8(14)11(5)2/h4H,1-3H3 |
| InChIKey | NWCPBHZYJHWSEL-UHFFFAOYSA-N |
| XLogP | -1.03 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.19 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3,7,9-trimethylpurine-6,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7,9-trimethylpurine-6,8-dione?
The IUPAC name of 3,7,9-trimethylpurine-6,8-dione (CID 163041436) is 3,7,9-trimethylpurine-6,8-dione.
What is the SMILES notation for 3,7,9-trimethylpurine-6,8-dione?
The canonical SMILES for 3,7,9-trimethylpurine-6,8-dione is Cn1cnc(=O)c2c1n(C)c(=O)n2C.
What is the InChIKey of 3,7,9-trimethylpurine-6,8-dione?
The InChIKey is NWCPBHZYJHWSEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4O2/c1-10-4-9-6(13)5-7(10)12(3)8(14)11(5)2/h4H,1-3H3.
What are the key properties of 3,7,9-trimethylpurine-6,8-dione?
3,7,9-trimethylpurine-6,8-dione has a molecular weight of 194.19 g/mol, XLogP of -1.03, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7,9-trimethylpurine-6,8-dione is sourced from PubChem (CID 163041436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).