C32H46O5 — CID 163041573
ethyl 3-[4'-[1-(2-hydroxy-4-methyl-5-oxofuran-2-yl)propan-2-yl]-1',4,4'-trimethyl-5-prop-1-en-2-ylspiro[3,3a,5,6-tetrahydro-2H-indene-1,5'-cyclopentene]-4-yl]propanoate (PubChem CID 163041573) has the molecular formula C32H46O5 and a molecular weight of 510.72 g/mol. Its IUPAC name is ethyl 3-[4'-[1-(2-hydroxy-4-methyl-5-oxofuran-2-yl)propan-2-yl]-1',4,4'-trimethyl-5-prop-1-en-2-ylspiro[3,3a,5,6-tetrahydro-2H-indene-1,5'-cyclopentene]-4-yl]propanoate.
| Compound Name | ethyl 3-[4'-[1-(2-hydroxy-4-methyl-5-oxofuran-2-yl)propan-2-yl]-1',4,4'-trimethyl-5-prop-1-en-2-ylspiro[3,3a,5,6-tetrahydro-2H-indene-1,5'-cyclopentene]-4-yl]propanoate |
|---|---|
| PubChem CID | 163041573 |
| Molecular Formula | C32H46O5 |
| Molecular Weight | 510.72 g/mol |
| Exact Mass | 510.33 |
| IUPAC Name | ethyl 3-[4'-[1-(2-hydroxy-4-methyl-5-oxofuran-2-yl)propan-2-yl]-1',4,4'-trimethyl-5-prop-1-en-2-ylspiro[3,3a,5,6-tetrahydro-2H-indene-1,5'-cyclopentene]-4-yl]propanoate |
| SMILES | C=C(C)C1CC=C2C(CCC23C(C)=CCC3(C)C(C)CC2(O)C=C(C)C(=O)O2)C1(C)CCC(=O)OCC |
| InChI | InChI=1S/C32H46O5/c1-9-36-27(33)14-15-29(7)24(20(2)3)10-11-26-25(29)13-17-32(26)22(5)12-16-30(32,8)23(6)19-31(35)18-21(4)28(34)37-31/h11-12,18,23-25,35H,2,9-10,13-17,19H2,1,3-8H3 |
| InChIKey | GWTOQEBQDIMEKO-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.72 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|