C20H32O4 — CID 163041650
[(1R,3aS,4S,4aR,8aS,8bS)-1-hydroxy-4a,8,8,8a-tetramethyl-1,3,3a,4,5,6,7,8b-octahydroindeno[1,2-c]furan-4-yl] (Z)-2-methylbut-2-enoate (PubChem CID 163041650) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is [(1R,3aS,4S,4aR,8aS,8bS)-1-hydroxy-4a,8,8,8a-tetramethyl-1,3,3a,4,5,6,7,8b-octahydroindeno[1,2-c]furan-4-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(1R,3aS,4S,4aR,8aS,8bS)-1-hydroxy-4a,8,8,8a-tetramethyl-1,3,3a,4,5,6,7,8b-octahydroindeno[1,2-c]furan-4-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 163041650 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | [(1R,3aS,4S,4aR,8aS,8bS)-1-hydroxy-4a,8,8,8a-tetramethyl-1,3,3a,4,5,6,7,8b-octahydroindeno[1,2-c]furan-4-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)O[C@H]1[C@@H]2CO[C@@H](O)[C@@H]2[C@@]2(C)C(C)(C)CCC[C@@]12C |
| InChI | InChI=1S/C20H32O4/c1-7-12(2)16(21)24-15-13-11-23-17(22)14(13)20(6)18(3,4)9-8-10-19(15,20)5/h7,13-15,17,22H,8-11H2,1-6H3/b12-7-/t13-,14-,15+,17-,19+,20+/m1/s1 |
| InChIKey | WYCGITBNEASEQG-BZYUOXPESA-N |
| XLogP | 3.68 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|