C26H38O7 — CID 163041895
[(2S,3R,4Z,5S)-4-[2-[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]ethylidene]-2,5-diacetyloxyoxolan-3-yl] acetate (PubChem CID 163041895) has the molecular formula C26H38O7 and a molecular weight of 462.58 g/mol. Its IUPAC name is [(2S,3R,4Z,5S)-4-[2-[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]ethylidene]-2,5-diacetyloxyoxolan-3-yl] acetate.
| Compound Name | [(2S,3R,4Z,5S)-4-[2-[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]ethylidene]-2,5-diacetyloxyoxolan-3-yl] acetate |
|---|---|
| PubChem CID | 163041895 |
| Molecular Formula | C26H38O7 |
| Molecular Weight | 462.58 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | [(2S,3R,4Z,5S)-4-[2-[(1S,2R,4aR,8aR)-1,2,4a,5-tetramethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]ethylidene]-2,5-diacetyloxyoxolan-3-yl] acetate |
| SMILES | CC(=O)O[C@@H]1O[C@@H](OC(C)=O)[C@H](OC(C)=O)/C1=C/C[C@@]1(C)[C@H](C)CC[C@@]2(C)C(C)=CCC[C@H]12 |
| InChI | InChI=1S/C26H38O7/c1-15-9-8-10-21-25(15,6)13-11-16(2)26(21,7)14-12-20-22(30-17(3)27)24(32-19(5)29)33-23(20)31-18(4)28/h9,12,16,21-24H,8,10-11,13-14H2,1-7H3/b20-12-/t16-,21+,22-,23-,24-,25+,26+/m1/s1 |
| InChIKey | DCEVVUKCSPESMF-DIRTWKLVSA-N |
| XLogP | 4.84 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.58 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|