C25H30O10 — CID 163042037
[(1S,4aS,6S,7R,7aS)-4-formyl-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-6-yl] 3-phenylprop-2-enoate (PubChem CID 163042037) has the molecular formula C25H30O10 and a molecular weight of 490.51 g/mol. Its IUPAC name is [(1S,4aS,6S,7R,7aS)-4-formyl-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-6-yl] 3-phenylprop-2-enoate.
| Compound Name | [(1S,4aS,6S,7R,7aS)-4-formyl-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-6-yl] 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 163042037 |
| Molecular Formula | C25H30O10 |
| Molecular Weight | 490.51 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | [(1S,4aS,6S,7R,7aS)-4-formyl-7-methyl-1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,4a,5,6,7,7a-hexahydrocyclopenta[c]pyran-6-yl] 3-phenylprop-2-enoate |
| SMILES | C[C@@H]1[C@H]2[C@H](O[C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)OC=C(C=O)[C@H]2C[C@@H]1OC(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C25H30O10/c1-13-17(33-19(28)8-7-14-5-3-2-4-6-14)9-16-15(10-26)12-32-24(20(13)16)35-25-23(31)22(30)21(29)18(11-27)34-25/h2-8,10,12-13,16-18,20-25,27,29-31H,9,11H2,1H3/t13-,16+,17-,18+,20+,21+,22-,23+,24-,25-/m0/s1 |
| InChIKey | LEMYEEHONYESNR-SIILQOQYSA-N |
| XLogP | 0.14 |
| TPSA | 151.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.51 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|