C20H36O2 — CID 163042436
methyl (5Z,9Z,16S)-16-methyloctadeca-5,9-dienoate (PubChem CID 163042436) has the molecular formula C20H36O2 and a molecular weight of 308.51 g/mol. Its IUPAC name is methyl (5Z,9Z,16S)-16-methyloctadeca-5,9-dienoate.
| Compound Name | methyl (5Z,9Z,16S)-16-methyloctadeca-5,9-dienoate |
|---|---|
| PubChem CID | 163042436 |
| Molecular Formula | C20H36O2 |
| Molecular Weight | 308.51 g/mol |
| Exact Mass | 308.27 |
| IUPAC Name | methyl (5Z,9Z,16S)-16-methyloctadeca-5,9-dienoate |
| SMILES | CC[C@H](C)CCCCC/C=C\CC/C=C\CCCC(=O)OC |
| InChI | InChI=1S/C20H36O2/c1-4-19(2)17-15-13-11-9-7-5-6-8-10-12-14-16-18-20(21)22-3/h5,7,10,12,19H,4,6,8-9,11,13-18H2,1-3H3/b7-5-,12-10-/t19-/m0/s1 |
| InChIKey | LGWLRWVMEWETLJ-WPPRWELVSA-N |
| XLogP | 6.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.51 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|