C17H28O3 — CID 163042557
[(E,6R)-6-[(1S,4R)-4-hydroxy-4-methylcyclohex-2-en-1-yl]-2-methylhept-2-enyl] acetate (PubChem CID 163042557) has the molecular formula C17H28O3 and a molecular weight of 280.41 g/mol. Its IUPAC name is [(E,6R)-6-[(1S,4R)-4-hydroxy-4-methylcyclohex-2-en-1-yl]-2-methylhept-2-enyl] acetate.
| Compound Name | [(E,6R)-6-[(1S,4R)-4-hydroxy-4-methylcyclohex-2-en-1-yl]-2-methylhept-2-enyl] acetate |
|---|---|
| PubChem CID | 163042557 |
| Molecular Formula | C17H28O3 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.20 |
| IUPAC Name | [(E,6R)-6-[(1S,4R)-4-hydroxy-4-methylcyclohex-2-en-1-yl]-2-methylhept-2-enyl] acetate |
| SMILES | CC(=O)OC/C(C)=C/CC[C@@H](C)[C@H]1C=C[C@](C)(O)CC1 |
| InChI | InChI=1S/C17H28O3/c1-13(12-20-15(3)18)6-5-7-14(2)16-8-10-17(4,19)11-9-16/h6,8,10,14,16,19H,5,7,9,11-12H2,1-4H3/b13-6+/t14-,16+,17+/m1/s1 |
| InChIKey | XHHPQPUHYIXWGX-XWXNAYNKSA-N |
| XLogP | 3.63 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|