C7H10O5 — CID 163043140
(1R,3R,4S,5S)-3,4-dihydroxy-4-[(1R)-1-hydroxyethyl]-6-oxabicyclo[3.1.0]hexan-2-one (PubChem CID 163043140) has the molecular formula C7H10O5 and a molecular weight of 174.15 g/mol. Its IUPAC name is (1R,3R,4S,5S)-3,4-dihydroxy-4-[(1R)-1-hydroxyethyl]-6-oxabicyclo[3.1.0]hexan-2-one.
| Compound Name | (1R,3R,4S,5S)-3,4-dihydroxy-4-[(1R)-1-hydroxyethyl]-6-oxabicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 163043140 |
| Molecular Formula | C7H10O5 |
| Molecular Weight | 174.15 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | (1R,3R,4S,5S)-3,4-dihydroxy-4-[(1R)-1-hydroxyethyl]-6-oxabicyclo[3.1.0]hexan-2-one |
| SMILES | C[C@@H](O)[C@]1(O)[C@@H](O)C(=O)[C@@H]2O[C@@H]21 |
| InChI | InChI=1S/C7H10O5/c1-2(8)7(11)5(10)3(9)4-6(7)12-4/h2,4-6,8,10-11H,1H3/t2-,4+,5+,6+,7+/m1/s1 |
| InChIKey | YKKGNOGHAJQEDF-FPBYKHMASA-N |
| XLogP | -2.19 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.15 |
| LogP ≤ 5 | -2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|