C20H24O6 — CID 163043827
(10-ethyl-6-formyl-4-hydroxy-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-5-yl) 2-methylprop-2-enoate (PubChem CID 163043827) has the molecular formula C20H24O6 and a molecular weight of 360.41 g/mol. Its IUPAC name is (10-ethyl-6-formyl-4-hydroxy-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-5-yl) 2-methylprop-2-enoate.
| Compound Name | (10-ethyl-6-formyl-4-hydroxy-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-5-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 163043827 |
| Molecular Formula | C20H24O6 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (10-ethyl-6-formyl-4-hydroxy-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-5-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC1C(C=O)=CCCC(CC)=CC2OC(=O)C(=C)C2C1O |
| InChI | InChI=1S/C20H24O6/c1-5-13-7-6-8-14(10-21)18(26-19(23)11(2)3)17(22)16-12(4)20(24)25-15(16)9-13/h8-10,15-18,22H,2,4-7H2,1,3H3 |
| InChIKey | XDSRCXGGTYGDHK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|