C19H30O3 — CID 163043850
(1S,6R,9R,10R)-10-[(4S)-4-hydroxypentanoyl]-6,10-dimethyl-2-methylidenebicyclo[7.2.0]undecan-5-one (PubChem CID 163043850) has the molecular formula C19H30O3 and a molecular weight of 306.45 g/mol. Its IUPAC name is (1S,6R,9R,10R)-10-[(4S)-4-hydroxypentanoyl]-6,10-dimethyl-2-methylidenebicyclo[7.2.0]undecan-5-one.
| Compound Name | (1S,6R,9R,10R)-10-[(4S)-4-hydroxypentanoyl]-6,10-dimethyl-2-methylidenebicyclo[7.2.0]undecan-5-one |
|---|---|
| PubChem CID | 163043850 |
| Molecular Formula | C19H30O3 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | (1S,6R,9R,10R)-10-[(4S)-4-hydroxypentanoyl]-6,10-dimethyl-2-methylidenebicyclo[7.2.0]undecan-5-one |
| SMILES | C=C1CCC(=O)[C@H](C)CC[C@@H]2[C@@H]1C[C@@]2(C)C(=O)CC[C@H](C)O |
| InChI | InChI=1S/C19H30O3/c1-12-6-9-17(21)13(2)5-8-16-15(12)11-19(16,4)18(22)10-7-14(3)20/h13-16,20H,1,5-11H2,2-4H3/t13-,14+,15-,16-,19-/m1/s1 |
| InChIKey | DEVSVQNOYWLYHI-PPLBCVRQSA-N |
| XLogP | 3.69 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|