C36H60O9 — CID 163044037
2-[[4,7-dihydroxy-1,2,6,6,10,17-hexamethyl-15-(2-methylprop-1-enyl)-14-oxapentacyclo[11.7.1.02,11.05,10.018,21]henicosan-17-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 163044037) has the molecular formula C36H60O9 and a molecular weight of 636.87 g/mol. Its IUPAC name is 2-[[4,7-dihydroxy-1,2,6,6,10,17-hexamethyl-15-(2-methylprop-1-enyl)-14-oxapentacyclo[11.7.1.02,11.05,10.018,21]henicosan-17-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | 2-[[4,7-dihydroxy-1,2,6,6,10,17-hexamethyl-15-(2-methylprop-1-enyl)-14-oxapentacyclo[11.7.1.02,11.05,10.018,21]henicosan-17-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 163044037 |
| Molecular Formula | C36H60O9 |
| Molecular Weight | 636.87 g/mol |
| Exact Mass | 636.42 |
| IUPAC Name | 2-[[4,7-dihydroxy-1,2,6,6,10,17-hexamethyl-15-(2-methylprop-1-enyl)-14-oxapentacyclo[11.7.1.02,11.05,10.018,21]henicosan-17-yl]oxy]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CC(C)=CC1CC(C)(OC2OC(CO)C(O)C(O)C2O)C2CCC3(C)C2C(CC2C4(C)CCC(O)C(C)(C)C4C(O)CC23C)O1 |
| InChI | InChI=1S/C36H60O9/c1-18(2)13-19-15-36(8,45-31-29(42)28(41)27(40)23(17-37)44-31)20-9-12-34(6)26(20)22(43-19)14-24-33(5)11-10-25(39)32(3,4)30(33)21(38)16-35(24,34)7/h13,19-31,37-42H,9-12,14-17H2,1-8H3 |
| InChIKey | NUMKZMRCFMHDGU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 149.07 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.87 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|