C20H22O7 — CID 163044116
(3aS,5'S,6aS,7R,8S,10S,10aR)-5'-(furan-2-yl)-3a,10-dihydroxy-8-methylspiro[1,6,6a,8,9,10-hexahydrobenzo[d][2]benzofuran-7,3'-oxolane]-2',3-dione (PubChem CID 163044116) has the molecular formula C20H22O7 and a molecular weight of 374.39 g/mol. Its IUPAC name is (3aS,5'S,6aS,7R,8S,10S,10aR)-5'-(furan-2-yl)-3a,10-dihydroxy-8-methylspiro[1,6,6a,8,9,10-hexahydrobenzo[d][2]benzofuran-7,3'-oxolane]-2',3-dione.
| Compound Name | (3aS,5'S,6aS,7R,8S,10S,10aR)-5'-(furan-2-yl)-3a,10-dihydroxy-8-methylspiro[1,6,6a,8,9,10-hexahydrobenzo[d][2]benzofuran-7,3'-oxolane]-2',3-dione |
|---|---|
| PubChem CID | 163044116 |
| Molecular Formula | C20H22O7 |
| Molecular Weight | 374.39 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | (3aS,5'S,6aS,7R,8S,10S,10aR)-5'-(furan-2-yl)-3a,10-dihydroxy-8-methylspiro[1,6,6a,8,9,10-hexahydrobenzo[d][2]benzofuran-7,3'-oxolane]-2',3-dione |
| SMILES | C[C@H]1C[C@H](O)[C@@]23COC(=O)[C@]2(O)C=CC[C@@H]3[C@@]12C[C@@H](c1ccco1)OC2=O |
| InChI | InChI=1S/C20H22O7/c1-11-8-15(21)19-10-26-17(23)20(19,24)6-2-5-14(19)18(11)9-13(27-16(18)22)12-4-3-7-25-12/h2-4,6-7,11,13-15,21,24H,5,8-10H2,1H3/t11-,13-,14+,15-,18+,19-,20+/m0/s1 |
| InChIKey | FWBDOAZPIBAABI-HFIALKEHSA-N |
| XLogP | 1.51 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.39 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|