C23H29N3O — CID 163044165
4-methoxy-23,24,25-triazatetracyclo[18.2.1.12,5.17,10]pentacosa-1(22),2,4,6,8,10(24),20-heptaene (PubChem CID 163044165) has the molecular formula C23H29N3O and a molecular weight of 363.51 g/mol. Its IUPAC name is 4-methoxy-23,24,25-triazatetracyclo[18.2.1.12,5.17,10]pentacosa-1(22),2,4,6,8,10(24),20-heptaene.
| Compound Name | 4-methoxy-23,24,25-triazatetracyclo[18.2.1.12,5.17,10]pentacosa-1(22),2,4,6,8,10(24),20-heptaene |
|---|---|
| PubChem CID | 163044165 |
| Molecular Formula | C23H29N3O |
| Molecular Weight | 363.51 g/mol |
| Exact Mass | 363.23 |
| IUPAC Name | 4-methoxy-23,24,25-triazatetracyclo[18.2.1.12,5.17,10]pentacosa-1(22),2,4,6,8,10(24),20-heptaene |
| SMILES | COc1cc2[nH]c1C=C1C=CC(=N1)CCCCCCCCCc1ccc-2[nH]1 |
| InChI | InChI=1S/C23H29N3O/c1-27-23-16-21-20-14-13-18(25-20)10-8-6-4-2-3-5-7-9-17-11-12-19(24-17)15-22(23)26-21/h11-16,25-26H,2-10H2,1H3 |
| InChIKey | WSBAYYSUBYBDQS-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.51 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |