C31H52 — CID 163044821
(3R,6E,10S,11E,13S,16E)-10-ethenyl-2,3,6,10,13,17,21-heptamethyldocosa-1,6,11,16,20-pentaene (PubChem CID 163044821) has the molecular formula C31H52 and a molecular weight of 424.76 g/mol. Its IUPAC name is (3R,6E,10S,11E,13S,16E)-10-ethenyl-2,3,6,10,13,17,21-heptamethyldocosa-1,6,11,16,20-pentaene.
| Compound Name | (3R,6E,10S,11E,13S,16E)-10-ethenyl-2,3,6,10,13,17,21-heptamethyldocosa-1,6,11,16,20-pentaene |
|---|---|
| PubChem CID | 163044821 |
| Molecular Formula | C31H52 |
| Molecular Weight | 424.76 g/mol |
| Exact Mass | 424.41 |
| IUPAC Name | (3R,6E,10S,11E,13S,16E)-10-ethenyl-2,3,6,10,13,17,21-heptamethyldocosa-1,6,11,16,20-pentaene |
| SMILES | C=C[C@@](C)(/C=C/[C@@H](C)CC/C=C(\C)CCC=C(C)C)CC/C=C(\C)CC[C@@H](C)C(=C)C |
| InChI | InChI=1S/C31H52/c1-11-31(10,23-14-19-28(7)20-21-30(9)26(4)5)24-22-29(8)18-13-17-27(6)16-12-15-25(2)3/h11,15,17,19,22,24,29-30H,1,4,12-14,16,18,20-21,23H2,2-3,5-10H3/b24-22+,27-17+,28-19+/t29-,30+,31+/m0/s1 |
| InChIKey | UJRFKENHJISTAF-DQHTYVKMSA-N |
| XLogP | 10.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.76 |
| LogP ≤ 5 | 10.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|