C28H42O8 — CID 163044950
[16-acetyloxy-3,11-bis(acetyloxymethyl)-7,15-dimethylhexadeca-2,6,10,14-tetraenyl] acetate (PubChem CID 163044950) has the molecular formula C28H42O8 and a molecular weight of 506.64 g/mol. Its IUPAC name is [16-acetyloxy-3,11-bis(acetyloxymethyl)-7,15-dimethylhexadeca-2,6,10,14-tetraenyl] acetate.
| Compound Name | [16-acetyloxy-3,11-bis(acetyloxymethyl)-7,15-dimethylhexadeca-2,6,10,14-tetraenyl] acetate |
|---|---|
| PubChem CID | 163044950 |
| Molecular Formula | C28H42O8 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | [16-acetyloxy-3,11-bis(acetyloxymethyl)-7,15-dimethylhexadeca-2,6,10,14-tetraenyl] acetate |
| SMILES | CC(=O)OCC=C(CCC=C(C)CCC=C(CCC=C(C)COC(C)=O)COC(C)=O)COC(C)=O |
| InChI | InChI=1S/C28H42O8/c1-21(11-8-15-28(20-36-26(6)32)16-17-33-23(3)29)10-7-13-27(19-35-25(5)31)14-9-12-22(2)18-34-24(4)30/h11-13,16H,7-10,14-15,17-20H2,1-6H3 |
| InChIKey | UQJOWSCILFOFQR-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|