C27H18O13 — CID 163045924
5-acetyl-2,3-dihydroxy-6-methyl-9-oxo-7-[(3S)-3,6,7-trihydroxy-4-oxo-2H-chromene-3-carbonyl]xanthene-1-carboxylic acid (PubChem CID 163045924) has the molecular formula C27H18O13 and a molecular weight of 550.43 g/mol. Its IUPAC name is 5-acetyl-2,3-dihydroxy-6-methyl-9-oxo-7-[(3S)-3,6,7-trihydroxy-4-oxo-2H-chromene-3-carbonyl]xanthene-1-carboxylic acid.
| Compound Name | 5-acetyl-2,3-dihydroxy-6-methyl-9-oxo-7-[(3S)-3,6,7-trihydroxy-4-oxo-2H-chromene-3-carbonyl]xanthene-1-carboxylic acid |
|---|---|
| PubChem CID | 163045924 |
| Molecular Formula | C27H18O13 |
| Molecular Weight | 550.43 g/mol |
| Exact Mass | 550.07 |
| IUPAC Name | 5-acetyl-2,3-dihydroxy-6-methyl-9-oxo-7-[(3S)-3,6,7-trihydroxy-4-oxo-2H-chromene-3-carbonyl]xanthene-1-carboxylic acid |
| SMILES | CC(=O)c1c(C)c(C(=O)[C@@]2(O)COc3cc(O)c(O)cc3C2=O)cc2c(=O)c3c(C(=O)O)c(O)c(O)cc3oc12 |
| InChI | InChI=1S/C27H18O13/c1-8-10(24(34)27(38)7-39-16-5-14(30)13(29)4-11(16)25(27)35)3-12-21(32)19-17(40-23(12)18(8)9(2)28)6-15(31)22(33)20(19)26(36)37/h3-6,29-31,33,38H,7H2,1-2H3,(H,36,37)/t27-/m0/s1 |
| InChIKey | ZFYVQYPQSSHPTI-MHZLTWQESA-N |
| XLogP | 2.17 |
| TPSA | 229.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.43 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|