C30H42O9 — CID 163046007
5-[8,14-dihydroxy-10,13-dimethyl-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-2,3,6,7,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pyran-2-one (PubChem CID 163046007) has the molecular formula C30H42O9 and a molecular weight of 546.66 g/mol. Its IUPAC name is 5-[8,14-dihydroxy-10,13-dimethyl-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-2,3,6,7,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pyran-2-one.
| Compound Name | 5-[8,14-dihydroxy-10,13-dimethyl-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-2,3,6,7,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pyran-2-one |
|---|---|
| PubChem CID | 163046007 |
| Molecular Formula | C30H42O9 |
| Molecular Weight | 546.66 g/mol |
| Exact Mass | 546.28 |
| IUPAC Name | 5-[8,14-dihydroxy-10,13-dimethyl-3-(3,4,5-trihydroxy-6-methyloxan-2-yl)oxy-2,3,6,7,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]pyran-2-one |
| SMILES | CC1OC(OC2C=C3CCC4(O)C(CCC5(C)C(c6ccc(=O)oc6)CCC54O)C3(C)CC2)C(O)C(O)C1O |
| InChI | InChI=1S/C30H42O9/c1-16-23(32)24(33)25(34)26(38-16)39-19-7-10-27(2)18(14-19)6-12-29(35)21(27)9-11-28(3)20(8-13-30(28,29)36)17-4-5-22(31)37-15-17/h4-5,14-16,19-21,23-26,32-36H,6-13H2,1-3H3 |
| InChIKey | IOUCAHDIONSWJC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 149.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.66 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|