C20H18O3 — CID 163046356
(9R)-3,4,9-trimethyl-9,10-dihydro-8H-naphtho[2,1-g]chromene-7,12-dione (PubChem CID 163046356) has the molecular formula C20H18O3 and a molecular weight of 306.36 g/mol. Its IUPAC name is (9R)-3,4,9-trimethyl-9,10-dihydro-8H-naphtho[2,1-g]chromene-7,12-dione.
| Compound Name | (9R)-3,4,9-trimethyl-9,10-dihydro-8H-naphtho[2,1-g]chromene-7,12-dione |
|---|---|
| PubChem CID | 163046356 |
| Molecular Formula | C20H18O3 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | (9R)-3,4,9-trimethyl-9,10-dihydro-8H-naphtho[2,1-g]chromene-7,12-dione |
| SMILES | Cc1ccc2c3c(ccc2c1C)C(=O)C1=C(OC[C@H](C)C1)C3=O |
| InChI | InChI=1S/C20H18O3/c1-10-8-16-18(21)15-7-6-13-12(3)11(2)4-5-14(13)17(15)19(22)20(16)23-9-10/h4-7,10H,8-9H2,1-3H3/t10-/m1/s1 |
| InChIKey | IRINNKUOFOYZDG-SNVBAGLBSA-N |
| XLogP | 4.15 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|