C15H22O5 — CID 163046366
2-[(3R,3aS,6S,7S,8R,8aR)-8-formyl-3,6,8-trimethyl-2-oxo-3a,4,5,6,7,8a-hexahydro-3H-cyclohepta[b]furan-7-yl]acetic acid (PubChem CID 163046366) has the molecular formula C15H22O5 and a molecular weight of 282.34 g/mol. Its IUPAC name is 2-[(3R,3aS,6S,7S,8R,8aR)-8-formyl-3,6,8-trimethyl-2-oxo-3a,4,5,6,7,8a-hexahydro-3H-cyclohepta[b]furan-7-yl]acetic acid.
| Compound Name | 2-[(3R,3aS,6S,7S,8R,8aR)-8-formyl-3,6,8-trimethyl-2-oxo-3a,4,5,6,7,8a-hexahydro-3H-cyclohepta[b]furan-7-yl]acetic acid |
|---|---|
| PubChem CID | 163046366 |
| Molecular Formula | C15H22O5 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.15 |
| IUPAC Name | 2-[(3R,3aS,6S,7S,8R,8aR)-8-formyl-3,6,8-trimethyl-2-oxo-3a,4,5,6,7,8a-hexahydro-3H-cyclohepta[b]furan-7-yl]acetic acid |
| SMILES | C[C@H]1CC[C@@H]2[C@@H](OC(=O)[C@@H]2C)[C@](C)(C=O)[C@H]1CC(=O)O |
| InChI | InChI=1S/C15H22O5/c1-8-4-5-10-9(2)14(19)20-13(10)15(3,7-16)11(8)6-12(17)18/h7-11,13H,4-6H2,1-3H3,(H,17,18)/t8-,9+,10-,11-,13+,15+/m0/s1 |
| InChIKey | ZECPBXBUYRVNDP-MYBATQTQSA-N |
| XLogP | 1.89 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|