C32H41ClN2O4 — CID 163046680
8-[[2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl(3-methoxypropyl)amino]methyl]-3-benzyl-6-chloro-7-hydroxy-4-methylchromen-2-one (PubChem CID 163046680) has the molecular formula C32H41ClN2O4 and a molecular weight of 553.14 g/mol. Its IUPAC name is 8-[[2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl(3-methoxypropyl)amino]methyl]-3-benzyl-6-chloro-7-hydroxy-4-methylchromen-2-one.
| Compound Name | 8-[[2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl(3-methoxypropyl)amino]methyl]-3-benzyl-6-chloro-7-hydroxy-4-methylchromen-2-one |
|---|---|
| PubChem CID | 163046680 |
| Molecular Formula | C32H41ClN2O4 |
| Molecular Weight | 553.14 g/mol |
| Exact Mass | 552.28 |
| IUPAC Name | 8-[[2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-ylmethyl(3-methoxypropyl)amino]methyl]-3-benzyl-6-chloro-7-hydroxy-4-methylchromen-2-one |
| SMILES | COCCCN(Cc1c(O)c(Cl)cc2c(C)c(Cc3ccccc3)c(=O)oc12)CC1CCCN2CCCCC12 |
| InChI | InChI=1S/C32H41ClN2O4/c1-22-25-19-28(33)30(36)27(31(25)39-32(37)26(22)18-23-10-4-3-5-11-23)21-34(14-9-17-38-2)20-24-12-8-16-35-15-7-6-13-29(24)35/h3-5,10-11,19,24,29,36H,6-9,12-18,20-21H2,1-2H3 |
| InChIKey | UWDWHQIBJYUYBQ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 66.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.14 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|