C9H16O3 — CID 163046842
(2E,3S,4S)-2-[(E)-but-2-enylidene]pentane-1,3,4-triol (PubChem CID 163046842) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is (2E,3S,4S)-2-[(E)-but-2-enylidene]pentane-1,3,4-triol.
| Compound Name | (2E,3S,4S)-2-[(E)-but-2-enylidene]pentane-1,3,4-triol |
|---|---|
| PubChem CID | 163046842 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | (2E,3S,4S)-2-[(E)-but-2-enylidene]pentane-1,3,4-triol |
| SMILES | C/C=C/C=C(\CO)[C@H](O)[C@H](C)O |
| InChI | InChI=1S/C9H16O3/c1-3-4-5-8(6-10)9(12)7(2)11/h3-5,7,9-12H,6H2,1-2H3/b4-3+,8-5+/t7-,9+/m0/s1 |
| InChIKey | RRFNHQIEVWBAEI-UUIPIBPQSA-N |
| XLogP | 0.22 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|