C34H58O — CID 163047153
(2S,3R)-2-methyl-3-[(3E,7R,11S)-4,7,11,12-tetramethyl-8-methylidenetrideca-3,12-dienyl]-2-[(3R,7R)-3,7,8-trimethyl-4-methylidenenon-8-enyl]oxirane (PubChem CID 163047153) has the molecular formula C34H58O and a molecular weight of 482.84 g/mol. Its IUPAC name is (2S,3R)-2-methyl-3-[(3E,7R,11S)-4,7,11,12-tetramethyl-8-methylidenetrideca-3,12-dienyl]-2-[(3R,7R)-3,7,8-trimethyl-4-methylidenenon-8-enyl]oxirane.
| Compound Name | (2S,3R)-2-methyl-3-[(3E,7R,11S)-4,7,11,12-tetramethyl-8-methylidenetrideca-3,12-dienyl]-2-[(3R,7R)-3,7,8-trimethyl-4-methylidenenon-8-enyl]oxirane |
|---|---|
| PubChem CID | 163047153 |
| Molecular Formula | C34H58O |
| Molecular Weight | 482.84 g/mol |
| Exact Mass | 482.45 |
| IUPAC Name | (2S,3R)-2-methyl-3-[(3E,7R,11S)-4,7,11,12-tetramethyl-8-methylidenetrideca-3,12-dienyl]-2-[(3R,7R)-3,7,8-trimethyl-4-methylidenenon-8-enyl]oxirane |
| SMILES | C=C(C)[C@H](C)CCC(=C)[C@H](C)CC[C@]1(C)O[C@@H]1CC/C=C(\C)CC[C@@H](C)C(=C)CC[C@H](C)C(=C)C |
| InChI | InChI=1S/C34H58O/c1-24(2)27(6)18-20-30(9)29(8)17-16-26(5)14-13-15-33-34(12,35-33)23-22-32(11)31(10)21-19-28(7)25(3)4/h14,27-29,32-33H,1,3,9-10,13,15-23H2,2,4-8,11-12H3/b26-14+/t27-,28+,29+,32+,33+,34-/m0/s1 |
| InChIKey | KYDXBRSKIBXHJY-OVWNDYISSA-N |
| XLogP | 10.80 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.84 |
| LogP ≤ 5 | 10.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|