9-hydroxy-2,6,8-trimethyltricyclo[5.3.1.01,5]undecane-6-carboxylic acid

C15H24O3 — CID 163047268

IUPAC9-hydroxy-2,6,8-trimethyltricyclo[5.3.1.01,5]undecane-6-carboxylic acid
SMILESCC1C(O)CC23CC1C(C)(C(=O)O)C2CCC3C
InChIInChI=1S/C15H24O3/c1-8-4-5-12-14(3,13(17)18)10-6-15(8,12)7-11(16)9(10)2/h8-12,16H,4-7H2,1-3H3,(H,17,18)
InChIKeyOMLUGBLYLSZBOX-UHFFFAOYSA-N
MW252.35 g/mol
LogP2.53
Rot. Bonds1

About 9-hydroxy-2,6,8-trimethyltricyclo[5.3.1.01,5]undecane-6-carboxylic acid

9-hydroxy-2,6,8-trimethyltricyclo[5.3.1.01,5]undecane-6-carboxylic acid (PubChem CID 163047268) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is 9-hydroxy-2,6,8-trimethyltricyclo[5.3.1.01,5]undecane-6-carboxylic acid.

Molecular Properties

Compound Name9-hydroxy-2,6,8-trimethyltricyclo[5.3.1.01,5]undecane-6-carboxylic acid
PubChem CID163047268
Molecular FormulaC15H24O3
Molecular Weight252.35 g/mol
Exact Mass252.17
IUPAC Name9-hydroxy-2,6,8-trimethyltricyclo[5.3.1.01,5]undecane-6-carboxylic acid
SMILESCC1C(O)CC23CC1C(C)(C(=O)O)C2CCC3C
InChIInChI=1S/C15H24O3/c1-8-4-5-12-14(3,13(17)18)10-6-15(8,12)7-11(16)9(10)2/h8-12,16H,4-7H2,1-3H3,(H,17,18)
InChIKeyOMLUGBLYLSZBOX-UHFFFAOYSA-N
XLogP2.53
TPSA57.53 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500252.35
LogP ≤ 52.53
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 9-hydroxy-2,6,8-trimethyltricyclo[5.3.1.01,5]undecane-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 9-hydroxy-2,6,8-trimethyltricyclo[5.3.1.01,5]undecane-6-carboxylic acid?
The IUPAC name of 9-hydroxy-2,6,8-trimethyltricyclo[5.3.1.01,5]undecane-6-carboxylic acid (CID 163047268) is 9-hydroxy-2,6,8-trimethyltricyclo[5.3.1.01,5]undecane-6-carboxylic acid.
What is the SMILES notation for 9-hydroxy-2,6,8-trimethyltricyclo[5.3.1.01,5]undecane-6-carboxylic acid?
The canonical SMILES for 9-hydroxy-2,6,8-trimethyltricyclo[5.3.1.01,5]undecane-6-carboxylic acid is CC1C(O)CC23CC1C(C)(C(=O)O)C2CCC3C.
What is the InChIKey of 9-hydroxy-2,6,8-trimethyltricyclo[5.3.1.01,5]undecane-6-carboxylic acid?
The InChIKey is OMLUGBLYLSZBOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24O3/c1-8-4-5-12-14(3,13(17)18)10-6-15(8,12)7-11(16)9(10)2/h8-12,16H,4-7H2,1-3H3,(H,17,18).
What are the key properties of 9-hydroxy-2,6,8-trimethyltricyclo[5.3.1.01,5]undecane-6-carboxylic acid?
9-hydroxy-2,6,8-trimethyltricyclo[5.3.1.01,5]undecane-6-carboxylic acid has a molecular weight of 252.35 g/mol, XLogP of 2.53, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-hydroxy-2,6,8-trimethyltricyclo[5.3.1.01,5]undecane-6-carboxylic acid is sourced from PubChem (CID 163047268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).