About (3R)-3,10-dimethyl-3-(4-methylpent-3-enyl)-7H-pyrano[2,3-c]carbazole
(3R)-3,10-dimethyl-3-(4-methylpent-3-enyl)-7H-pyrano[2,3-c]carbazole (PubChem CID 163048192) has the molecular formula C23H25NO
and a molecular weight of 331.46 g/mol. Its IUPAC name is (3R)-3,10-dimethyl-3-(4-methylpent-3-enyl)-7H-pyrano[2,3-c]carbazole.
Molecular Properties
| Compound Name | (3R)-3,10-dimethyl-3-(4-methylpent-3-enyl)-7H-pyrano[2,3-c]carbazole |
| PubChem CID | 163048192 |
| Molecular Formula | C23H25NO |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | (3R)-3,10-dimethyl-3-(4-methylpent-3-enyl)-7H-pyrano[2,3-c]carbazole |
| SMILES | CC(C)=CCC[C@]1(C)C=Cc2c(ccc3[nH]c4ccc(C)cc4c23)O1 |
| InChI | InChI=1S/C23H25NO/c1-15(2)6-5-12-23(4)13-11-17-21(25-23)10-9-20-22(17)18-14-16(3)7-8-19(18)24-20/h6-11,13-14,24H,5,12H2,1-4H3/t23-/m1/s1 |
| InChIKey | QJRWTBSLVJRRRF-HSZRJFAPSA-N |
| XLogP | 6.54 |
| TPSA | 25.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R)-3,10-dimethyl-3-(4-methylpent-3-enyl)-7H-pyrano[2,3-c]carbazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3,10-dimethyl-3-(4-methylpent-3-enyl)-7H-pyrano[2,3-c]carbazole?
The IUPAC name of (3R)-3,10-dimethyl-3-(4-methylpent-3-enyl)-7H-pyrano[2,3-c]carbazole (CID 163048192) is (3R)-3,10-dimethyl-3-(4-methylpent-3-enyl)-7H-pyrano[2,3-c]carbazole.
What is the SMILES notation for (3R)-3,10-dimethyl-3-(4-methylpent-3-enyl)-7H-pyrano[2,3-c]carbazole?
The canonical SMILES for (3R)-3,10-dimethyl-3-(4-methylpent-3-enyl)-7H-pyrano[2,3-c]carbazole is CC(C)=CCC[C@]1(C)C=Cc2c(ccc3[nH]c4ccc(C)cc4c23)O1.
What is the InChIKey of (3R)-3,10-dimethyl-3-(4-methylpent-3-enyl)-7H-pyrano[2,3-c]carbazole?
The InChIKey is QJRWTBSLVJRRRF-HSZRJFAPSA-N. The full InChI is InChI=1S/C23H25NO/c1-15(2)6-5-12-23(4)13-11-17-21(25-23)10-9-20-22(17)18-14-16(3)7-8-19(18)24-20/h6-11,13-14,24H,5,12H2,1-4H3/t23-/m1/s1.
What are the key properties of (3R)-3,10-dimethyl-3-(4-methylpent-3-enyl)-7H-pyrano[2,3-c]carbazole?
(3R)-3,10-dimethyl-3-(4-methylpent-3-enyl)-7H-pyrano[2,3-c]carbazole has a molecular weight of 331.46 g/mol, XLogP of 6.54, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3,10-dimethyl-3-(4-methylpent-3-enyl)-7H-pyrano[2,3-c]carbazole is sourced from PubChem (CID 163048192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).