About (10-acetyloxy-1,8-dimethyl-3-oxo-4-propan-2-ylidenespiro[4.5]dec-7-en-9-yl) acetate
(10-acetyloxy-1,8-dimethyl-3-oxo-4-propan-2-ylidenespiro[4.5]dec-7-en-9-yl) acetate (PubChem CID 163048245) has the molecular formula C19H26O5
and a molecular weight of 334.41 g/mol. Its IUPAC name is (10-acetyloxy-1,8-dimethyl-3-oxo-4-propan-2-ylidenespiro[4.5]dec-7-en-9-yl) acetate.
Molecular Properties
| Compound Name | (10-acetyloxy-1,8-dimethyl-3-oxo-4-propan-2-ylidenespiro[4.5]dec-7-en-9-yl) acetate |
| PubChem CID | 163048245 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | (10-acetyloxy-1,8-dimethyl-3-oxo-4-propan-2-ylidenespiro[4.5]dec-7-en-9-yl) acetate |
| SMILES | CC(=O)OC1C(C)=CCC2(C(=C(C)C)C(=O)CC2C)C1OC(C)=O |
| InChI | InChI=1S/C19H26O5/c1-10(2)16-15(22)9-12(4)19(16)8-7-11(3)17(23-13(5)20)18(19)24-14(6)21/h7,12,17-18H,8-9H2,1-6H3 |
| InChIKey | KTPMGTIXJWEUNR-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (10-acetyloxy-1,8-dimethyl-3-oxo-4-propan-2-ylidenespiro[4.5]dec-7-en-9-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (10-acetyloxy-1,8-dimethyl-3-oxo-4-propan-2-ylidenespiro[4.5]dec-7-en-9-yl) acetate?
The IUPAC name of (10-acetyloxy-1,8-dimethyl-3-oxo-4-propan-2-ylidenespiro[4.5]dec-7-en-9-yl) acetate (CID 163048245) is (10-acetyloxy-1,8-dimethyl-3-oxo-4-propan-2-ylidenespiro[4.5]dec-7-en-9-yl) acetate.
What is the SMILES notation for (10-acetyloxy-1,8-dimethyl-3-oxo-4-propan-2-ylidenespiro[4.5]dec-7-en-9-yl) acetate?
The canonical SMILES for (10-acetyloxy-1,8-dimethyl-3-oxo-4-propan-2-ylidenespiro[4.5]dec-7-en-9-yl) acetate is CC(=O)OC1C(C)=CCC2(C(=C(C)C)C(=O)CC2C)C1OC(C)=O.
What is the InChIKey of (10-acetyloxy-1,8-dimethyl-3-oxo-4-propan-2-ylidenespiro[4.5]dec-7-en-9-yl) acetate?
The InChIKey is KTPMGTIXJWEUNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26O5/c1-10(2)16-15(22)9-12(4)19(16)8-7-11(3)17(23-13(5)20)18(19)24-14(6)21/h7,12,17-18H,8-9H2,1-6H3.
What are the key properties of (10-acetyloxy-1,8-dimethyl-3-oxo-4-propan-2-ylidenespiro[4.5]dec-7-en-9-yl) acetate?
(10-acetyloxy-1,8-dimethyl-3-oxo-4-propan-2-ylidenespiro[4.5]dec-7-en-9-yl) acetate has a molecular weight of 334.41 g/mol, XLogP of 3.13, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (10-acetyloxy-1,8-dimethyl-3-oxo-4-propan-2-ylidenespiro[4.5]dec-7-en-9-yl) acetate is sourced from PubChem (CID 163048245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).