C15H24O3 — CID 163048352
(3S,3aS,4S,6R,7aR)-6-hydroxy-3-[(1S)-1-hydroxyethyl]-7-methylidene-4-propan-2-yl-3,3a,4,5,6,7a-hexahydro-1H-inden-2-one (PubChem CID 163048352) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (3S,3aS,4S,6R,7aR)-6-hydroxy-3-[(1S)-1-hydroxyethyl]-7-methylidene-4-propan-2-yl-3,3a,4,5,6,7a-hexahydro-1H-inden-2-one.
| Compound Name | (3S,3aS,4S,6R,7aR)-6-hydroxy-3-[(1S)-1-hydroxyethyl]-7-methylidene-4-propan-2-yl-3,3a,4,5,6,7a-hexahydro-1H-inden-2-one |
|---|---|
| PubChem CID | 163048352 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (3S,3aS,4S,6R,7aR)-6-hydroxy-3-[(1S)-1-hydroxyethyl]-7-methylidene-4-propan-2-yl-3,3a,4,5,6,7a-hexahydro-1H-inden-2-one |
| SMILES | C=C1[C@H](O)C[C@@H](C(C)C)[C@@H]2[C@@H]([C@H](C)O)C(=O)C[C@@H]12 |
| InChI | InChI=1S/C15H24O3/c1-7(2)10-5-12(17)8(3)11-6-13(18)14(9(4)16)15(10)11/h7,9-12,14-17H,3,5-6H2,1-2,4H3/t9-,10-,11-,12+,14-,15-/m0/s1 |
| InChIKey | NZWVZCYBBOPPOD-LOVAHEPDSA-N |
| XLogP | 1.78 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|