C35H49N3O5 — CID 163048635
(3R,6S,9S,13R)-6,9-dibenzyl-3-[(2S)-butan-2-yl]-13-[(2S)-octan-2-yl]-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone (PubChem CID 163048635) has the molecular formula C35H49N3O5 and a molecular weight of 591.79 g/mol. Its IUPAC name is (3R,6S,9S,13R)-6,9-dibenzyl-3-[(2S)-butan-2-yl]-13-[(2S)-octan-2-yl]-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone.
| Compound Name | (3R,6S,9S,13R)-6,9-dibenzyl-3-[(2S)-butan-2-yl]-13-[(2S)-octan-2-yl]-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone |
|---|---|
| PubChem CID | 163048635 |
| Molecular Formula | C35H49N3O5 |
| Molecular Weight | 591.79 g/mol |
| Exact Mass | 591.37 |
| IUPAC Name | (3R,6S,9S,13R)-6,9-dibenzyl-3-[(2S)-butan-2-yl]-13-[(2S)-octan-2-yl]-1-oxa-4,7,10-triazacyclotridecane-2,5,8,11-tetrone |
| SMILES | CCCCCC[C@H](C)[C@H]1CC(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)N[C@H]([C@@H](C)CC)C(=O)O1 |
| InChI | InChI=1S/C35H49N3O5/c1-5-7-8-11-16-25(4)30-23-31(39)36-28(21-26-17-12-9-13-18-26)33(40)37-29(22-27-19-14-10-15-20-27)34(41)38-32(24(3)6-2)35(42)43-30/h9-10,12-15,17-20,24-25,28-30,32H,5-8,11,16,21-23H2,1-4H3,(H,36,39)(H,37,40)(H,38,41)/t24-,25-,28-,29-,30+,32+/m0/s1 |
| InChIKey | WBVNIXQEIJHNJC-ZWOIWHCGSA-N |
| XLogP | 4.89 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.79 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|