C19H22O5 — CID 163048680
(1S,6R,9R,12S,16R)-6-[(2R)-1-hydroxypropan-2-yl]-1,12-dimethyl-5,10-dioxatetracyclo[7.6.1.02,7.012,16]hexadeca-2,7,13-triene-4,11-dione (PubChem CID 163048680) has the molecular formula C19H22O5 and a molecular weight of 330.38 g/mol. Its IUPAC name is (1S,6R,9R,12S,16R)-6-[(2R)-1-hydroxypropan-2-yl]-1,12-dimethyl-5,10-dioxatetracyclo[7.6.1.02,7.012,16]hexadeca-2,7,13-triene-4,11-dione.
| Compound Name | (1S,6R,9R,12S,16R)-6-[(2R)-1-hydroxypropan-2-yl]-1,12-dimethyl-5,10-dioxatetracyclo[7.6.1.02,7.012,16]hexadeca-2,7,13-triene-4,11-dione |
|---|---|
| PubChem CID | 163048680 |
| Molecular Formula | C19H22O5 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | (1S,6R,9R,12S,16R)-6-[(2R)-1-hydroxypropan-2-yl]-1,12-dimethyl-5,10-dioxatetracyclo[7.6.1.02,7.012,16]hexadeca-2,7,13-triene-4,11-dione |
| SMILES | C[C@H](CO)[C@H]1OC(=O)C=C2C1=C[C@H]1OC(=O)[C@@]3(C)C=CC[C@@]2(C)[C@@H]13 |
| InChI | InChI=1S/C19H22O5/c1-10(9-20)15-11-7-13-16-18(2,12(11)8-14(21)24-15)5-4-6-19(16,3)17(22)23-13/h4,6-8,10,13,15-16,20H,5,9H2,1-3H3/t10-,13-,15-,16-,18-,19+/m1/s1 |
| InChIKey | YOZWSTMXXFDWHA-DEIJXFBXSA-N |
| XLogP | 1.92 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|