C24H38O6 — CID 163049425
(3S)-5-[(1S,4aR,5R,8aR)-5-(3-carboxypropanoyloxymethyl)-2,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpentanoic acid (PubChem CID 163049425) has the molecular formula C24H38O6 and a molecular weight of 422.56 g/mol. Its IUPAC name is (3S)-5-[(1S,4aR,5R,8aR)-5-(3-carboxypropanoyloxymethyl)-2,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpentanoic acid.
| Compound Name | (3S)-5-[(1S,4aR,5R,8aR)-5-(3-carboxypropanoyloxymethyl)-2,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 163049425 |
| Molecular Formula | C24H38O6 |
| Molecular Weight | 422.56 g/mol |
| Exact Mass | 422.27 |
| IUPAC Name | (3S)-5-[(1S,4aR,5R,8aR)-5-(3-carboxypropanoyloxymethyl)-2,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl]-3-methylpentanoic acid |
| SMILES | CC1=CC[C@H]2[C@](C)(COC(=O)CCC(=O)O)CCC[C@]2(C)[C@H]1CC[C@H](C)CC(=O)O |
| InChI | InChI=1S/C24H38O6/c1-16(14-21(27)28)6-8-18-17(2)7-9-19-23(3,12-5-13-24(18,19)4)15-30-22(29)11-10-20(25)26/h7,16,18-19H,5-6,8-15H2,1-4H3,(H,25,26)(H,27,28)/t16-,18-,19-,23-,24+/m0/s1 |
| InChIKey | BSSGYOHVEPJDRQ-ZYNTZZCOSA-N |
| XLogP | 5.06 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.56 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|