C14H26O2 — CID 163049458
(2R,3S,5S)-3,5-diethyl-2-methyl-5-[(E)-pent-1-enyl]oxolan-2-ol (PubChem CID 163049458) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is (2R,3S,5S)-3,5-diethyl-2-methyl-5-[(E)-pent-1-enyl]oxolan-2-ol.
| Compound Name | (2R,3S,5S)-3,5-diethyl-2-methyl-5-[(E)-pent-1-enyl]oxolan-2-ol |
|---|---|
| PubChem CID | 163049458 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | (2R,3S,5S)-3,5-diethyl-2-methyl-5-[(E)-pent-1-enyl]oxolan-2-ol |
| SMILES | CCC/C=C/[C@]1(CC)C[C@H](CC)[C@](C)(O)O1 |
| InChI | InChI=1S/C14H26O2/c1-5-8-9-10-14(7-3)11-12(6-2)13(4,15)16-14/h9-10,12,15H,5-8,11H2,1-4H3/b10-9+/t12-,13+,14+/m0/s1 |
| InChIKey | YUFOLFJAYLDZGK-VAOFQHHVSA-N |
| XLogP | 3.65 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|