C21H28O5 — CID 163049960
[(1S,2S,4R,7E,10R,11R)-4,8-dimethyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-10-yl] (E)-3-methylpent-2-enoate (PubChem CID 163049960) has the molecular formula C21H28O5 and a molecular weight of 360.45 g/mol. Its IUPAC name is [(1S,2S,4R,7E,10R,11R)-4,8-dimethyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-10-yl] (E)-3-methylpent-2-enoate.
| Compound Name | [(1S,2S,4R,7E,10R,11R)-4,8-dimethyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-10-yl] (E)-3-methylpent-2-enoate |
|---|---|
| PubChem CID | 163049960 |
| Molecular Formula | C21H28O5 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | [(1S,2S,4R,7E,10R,11R)-4,8-dimethyl-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradec-7-en-10-yl] (E)-3-methylpent-2-enoate |
| SMILES | C=C1C(=O)O[C@H]2[C@H]1[C@H](OC(=O)/C=C(\C)CC)C/C(C)=C/CC[C@@]1(C)O[C@@H]21 |
| InChI | InChI=1S/C21H28O5/c1-6-12(2)11-16(22)24-15-10-13(3)8-7-9-21(5)19(26-21)18-17(15)14(4)20(23)25-18/h8,11,15,17-19H,4,6-7,9-10H2,1-3,5H3/b12-11+,13-8+/t15-,17-,18+,19+,21-/m1/s1 |
| InChIKey | YJSQLUZICYKYBA-WMKBIWPDSA-N |
| XLogP | 3.64 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|